For research use only. Not for therapeutic Use.
3,4-Dibromo-5H-furan-2-one(Cat No.:M100931)is a reactive intermediate widely used in organic synthesis, particularly in the development of bioactive compounds and specialty chemicals. The dibromo-substituted furanone structure allows for versatile chemical modifications, making it valuable in the synthesis of complex molecules with potential applications in pharmaceuticals and agrochemicals. This compound is also of interest in the study of natural product synthesis and medicinal chemistry. Its high reactivity and purity make it an essential tool for researchers exploring new synthetic pathways and developing novel therapeutic agents.
CAS Number | 149418-41-7 |
Molecular Formula | C4H2Br2O2 |
Purity | ≥95% |
Storage | Desiccate at RT |
IUPAC Name | 3,4-dibromo-2H-furan-5-one |
InChI | InChI=1S/C4H2Br2O2/c5-2-1-8-4(7)3(2)6/h1H2 |
InChIKey | UBAYSWXSWXORAN-UHFFFAOYSA-N |
SMILES | C1C(=C(C(=O)O1)Br)Br |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |