For research use only. Not for therapeutic Use.
3,4-Di-O-acetyl-L-fucal(Cat No.:I045045)is a synthetically modified derivative of L-fucal, a deoxy sugar closely related to L-fucose. In this compound, acetyl groups are selectively attached to the hydroxyl groups at the 3- and 4-positions, enhancing its stability and reactivity in chemical synthesis. It serves as a valuable intermediate in the preparation of fucose-containing glycoconjugates and oligosaccharides, which are important in cell signaling, immune recognition, and pathogen-host interactions. 3,4-Di-O-acetyl-L-fucal is widely used in glycoscience and carbohydrate chemistry for developing glycomimetics and studying biological roles of fucosylated structures.
| CAS Number | 54621-94-2 |
| Synonyms | [(2S,3R,4S)-3-acetyloxy-2-methyl-3,4-dihydro-2H-pyran-4-yl] acetate |
| Molecular Formula | C10H14O5 |
| Purity | ≥95% |
| IUPAC Name | [(2S,3R,4S)-3-acetyloxy-2-methyl-3,4-dihydro-2H-pyran-4-yl] acetate |
| InChI | InChI=1S/C10H14O5/c1-6-10(15-8(3)12)9(4-5-13-6)14-7(2)11/h4-6,9-10H,1-3H3/t6-,9-,10+/m0/s1 |
| InChIKey | NDEGMKQAZZBNBB-JMOVZRAMSA-N |
| SMILES | C[C@H]1[C@H]([C@H](C=CO1)OC(=O)C)OC(=O)C |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |