For research use only. Not for therapeutic Use.
3,3,6-Trimethylbenzo[c][1,2]oxaborol-1(3H)-ol(Cat No.:L007759), is a chemical compound with the molecular formula C₈H₁₀BO₂. This compound is characterized by its boron-containing oxazole ring, which consists of boron, carbon, hydrogen, and oxygen atoms. Oxaboroles have shown diverse biological activities and are of interest in medicinal chemistry. Researchers explore their potential as antifungal, antibacterial, and antiviral agents.
| CAS Number | 1437051-62-1 |
| Molecular Formula | C10H13BO2 |
| Purity | ≥95% |
| IUPAC Name | 1-hydroxy-3,3,6-trimethyl-2,1-benzoxaborole |
| InChI | InChI=1S/C10H13BO2/c1-7-4-5-8-9(6-7)11(12)13-10(8,2)3/h4-6,12H,1-3H3 |
| InChIKey | YHLJNIYISMRAQQ-UHFFFAOYSA-N |
| SMILES | B1(C2=C(C=CC(=C2)C)C(O1)(C)C)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |