For research use only. Not for therapeutic Use.
3,3′-Dithiobis-L-valine(Cat No.:C000180), is a chemical compound primarily used in biochemical and biophysical research. It consists of two valine molecules linked by a dithioether bond. This compound is employed as a reagent for studying protein structures and protein-protein interactions. It can form stable complexes with metal ions and proteins, making it valuable in various laboratory techniques, such as chromatography and spectroscopy, to investigate the binding affinities and structural properties of biomolecules.
| CAS Number | 113626-33-8 |
| Synonyms | Penicillamine Disulphide Impurity; |
| Molecular Formula | C₁₀H₂₀N₂O₄S₂ |
| Purity | ≥95% |
| Solubility | Aqueous Base (Slightly), Water (Slightly, Heated) |
| Appearance | White to Off-White Solid |
| Storage | 4°C |
| IUPAC Name | (2R)-2-amino-3-[[(1R)-1-amino-1-carboxy-2-methylpropan-2-yl]disulfanyl]-3-methylbutanoic acid |
| InChI | InChI=1S/C10H20N2O4S2/c1-9(2,5(11)7(13)14)17-18-10(3,4)6(12)8(15)16/h5-6H,11-12H2,1-4H3,(H,13,14)(H,15,16)/t5-,6-/m1/s1 |
| InChIKey | POYPKGFSZHXASD-PHDIDXHHSA-N |
| SMILES | CC(C)(C(C(=O)O)N)SSC(C)(C)C(C(=O)O)N |
| Reference | Marti-Prats, L., et al.: Neurosci. Lett., 483, 143 (2010), Singh, A., et al.: J. Pharm. Sci., 99, 3931 (2010), Everette, J., et al.: J. Agric. Food Chem., 58, 8139 (2010) |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |