For research use only. Not for therapeutic Use.
3,3′-Dimethylnaphthidine (Cat No.: M052555) is an aromatic diamine compound composed of two naphthalene rings connected through an amine bridge, each bearing a methyl group at the 3-position. This structure imparts rigidity and extended conjugation, making it valuable in the synthesis of dyes, pigments, and advanced organic materials. It serves as an important intermediate in producing azo dyes and polyimides, offering thermal stability and enhanced electronic properties. Its molecular framework is also explored in optical materials and high-performance polymers for industrial and electronic applications.
| CAS Number | 13138-48-2 |
| Molecular Formula | C22H20N2 |
| Purity | ≥95% |
| Storage | Desiccate at RT |
| IUPAC Name | 4-(4-amino-3-methylnaphthalen-1-yl)-2-methylnaphthalen-1-amine |
| InChI | InChI=1S/C22H20N2/c1-13-11-19(15-7-3-5-9-17(15)21(13)23)20-12-14(2)22(24)18-10-6-4-8-16(18)20/h3-12H,23-24H2,1-2H3 |
| InChIKey | FTEGMIZQLGXBNA-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2C(=C1)C3=CC(=C(C4=CC=CC=C43)N)C)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
