For research use only. Not for therapeutic Use.
3,3-Difluoropropanoic acid(Cat No.:L006802). It consists of a three-carbon propanoic acid backbone with fluorine atoms attached to the second and third carbon positions. This compound is vital in organic synthesis, serving as a key intermediate in the creation of various complex organic molecules, including pharmaceuticals and agrochemicals. Its unique structure allows for diverse chemical transformations, making it valuable in the design and synthesis of specialized organic compounds. Researchers use it as a versatile building block, contributing to advancements in drug discovery, materials science, and chemical research.
| CAS Number | 155142-69-1 |
| Molecular Formula | C3H4F2O2 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3,3-difluoropropanoic acid |
| InChI | InChI=1S/C3H4F2O2/c4-2(5)1-3(6)7/h2H,1H2,(H,6,7) |
| InChIKey | SHJWFIDAWODQSR-UHFFFAOYSA-N |
| SMILES | C(C(F)F)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |