For research use only. Not for therapeutic Use.
3,3-Difluorocyclobutanamine hydrochloride (Cat No.: R052187) is a halogenated, nitrogen-containing compound with the molecular formula C₄H₇ClF₂N. It features a cyclobutane ring substituted with two fluorine atoms at the 3-position and an amino group at the 1-position, present as its hydrochloride salt for enhanced stability and solubility. This compound is used as a versatile intermediate in medicinal chemistry and drug discovery, particularly in the synthesis of fluorinated building blocks, where the difluorinated cyclobutane moiety can impart unique conformational and metabolic properties to bioactive molecules.
| CAS Number | 637031-93-7 |
| Synonyms | (3,3-Difluorocyclobutyl)amine Hydrochloride; |
| Molecular Formula | C4H8ClF2N |
| Purity | ≥95% |
| Storage | Room temperature |
| Related CAS | 791061-00-2(free base) |
| IUPAC Name | 3,3-difluorocyclobutan-1-amine;hydrochloride |
| InChI | InChI=1S/C4H7F2N.ClH/c5-4(6)1-3(7)2-4;/h3H,1-2,7H2;1H |
| InChIKey | WLXXTHPAORBNIG-UHFFFAOYSA-N |
| SMILES | C1C(CC1(F)F)N.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |