For research use only. Not for therapeutic Use.
3,3′-Bithiophene（Cat No.:M289898）is a sulfur-containing heteroaromatic compound composed of two thiophene rings connected at their 3-positions. It is widely used as a key building block in the synthesis of conjugated polymers and organic semiconductors due to its excellent electron-rich character and planarity. 3,3′-Bithiophene plays a crucial role in the development of organic electronic materials such as OLEDs, OFETs, and photovoltaic cells. Its structure promotes effective π-conjugation and charge transport. Supplied at high purity, it is ideal for advanced materials research, organic electronics, and optoelectronic device fabrication.
| CAS Number | 3172-56-3 |
| Molecular Formula | C8H6S2 |
| Purity | ≥95% |
| IUPAC Name | 3-thiophen-3-ylthiophene |
| InChI | InChI=1S/C8H6S2/c1-3-9-5-7(1)8-2-4-10-6-8/h1-6H |
| InChIKey | IAAQEGBHNXAHBF-UHFFFAOYSA-N |
| SMILES | C1=CSC=C1C2=CSC=C2 |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
