3,3'''-(Anthracene-9,10-diyl)bis(([1,1':3',1''-terphenyl]-4,4''-dicarboxylic acid)) - CAS 913343-74-5

3,3”’-(Anthracene-9,10-diyl)bis(([1,1′:3′,1”-terphenyl]-4,4”-dicarboxylic acid)) (Cat.No:L004833) is a significant compound in materials science. Its distinctive structure, incorporating anthracene and terphenyl units, imparts specialized electronic and photophysical properties. This compound serves as a crucial building block in the synthesis of luminescent materials and organic semiconductors for applications in optoelectronic devices.

Catalog Number: L004833

CAS Number: 913343-74-5

Molecular Formula: C54H34O8

Molecular Weight:810.8

Purity: ≥95%

* For research use only. Not for human or veterinary use.


Property

Molecular Formula: C54H34O8
Molecular Weight810.8
Purity≥95%

Computed Descriptor

IUPAC Name2-[10-[2-carboxy-5-[3-(4-carboxyphenyl)phenyl]phenyl]anthracen-9-yl]-4-[3-(4-carboxyphenyl)phenyl]benzoic acid
InChIInChI=1S/C54H34O8/c55-51(56)33-19-15-31(16-20-33)35-7-5-9-37(27-35)39-23-25-45(53(59)60)47(29-39)49-41-11-1-2-12-42(41)50(44-14-4-3-13-43(44)49)48-30-40(24-26-46(48)54(61)62)38-10-6-8-36(28-38)32-17-21-34(22-18-32)52(57)58/h1-30H,(H,55,56)(H,57,58)(H,59,60)(H,61,62)
InChIKeyFCFWETFMNTVATB-UHFFFAOYSA-N