For research use only. Not for therapeutic Use.
3-Vinylbenzaldehyde is an aromatic aldehyde characterized by a vinyl group at the 3-position of the benzene ring and an aldehyde functional group. This structure imparts unique reactivity, making it valuable in organic synthesis and materials science. The vinyl group can participate in various chemical reactions, including polymerization and conjugate addition, allowing for the development of diverse compounds. 3-Vinylbenzaldehyde may also serve as a building block in the synthesis of pharmaceuticals and agrochemicals, facilitating the exploration of structure-activity relationships in research.
CAS Number | 19955-99-8 |
Molecular Formula | C9H8O |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 3-ethenylbenzaldehyde |
InChI | InChI=1S/C9H8O/c1-2-8-4-3-5-9(6-8)7-10/h2-7H,1H2 |
InChIKey | CATOVPRCMWIZLR-UHFFFAOYSA-N |
SMILES | C=CC1=CC(=CC=C1)C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |