For research use only. Not for therapeutic Use.
3-(Trifluoromethyl)pyridine-4-carboxylic acid(Cat No.:L015381)is a fluorinated heterocyclic compound used in pharmaceutical and agrochemical research. Featuring a pyridine ring with a trifluoromethyl group at the 3-position and a carboxylic acid group at the 4-position, this compound serves as a versatile intermediate in the synthesis of bioactive molecules. Its unique combination of fluorination and carboxylation enhances the chemical properties of target compounds, making it valuable in the development of drugs, herbicides, and other specialty chemicals. Its reactivity and stability are essential in advanced organic synthesis and medicinal chemistry.
| CAS Number | 590371-38-3 |
| Molecular Formula | C7H4F3NO2 |
| Purity | ≥95% |
| IUPAC Name | 3-(trifluoromethyl)pyridine-4-carboxylic acid |
| InChI | InChI=1S/C7H4F3NO2/c8-7(9,10)5-3-11-2-1-4(5)6(12)13/h1-3H,(H,12,13) |
| InChIKey | FBOSFEOQEZQFOC-UHFFFAOYSA-N |
| SMILES | C1=CN=CC(=C1C(=O)O)C(F)(F)F |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |