For research use only. Not for therapeutic Use.
3-(Trifluoromethyl)benzyl bromide (Cat No.:R048847) is a chemical compound. It features a benzene ring substituted with a trifluoromethyl group and a bromine atom. This compound is important in organic synthesis and chemical research due to its potential applications in various reactions. Trifluoromethyl-substituted compounds are valuable intermediates for creating diverse molecules, including pharmaceuticals and agrochemicals. The presence of a bromine atom and a trifluoromethyl group adds specific reactivity and functional diversity to the compound. 3-(Trifluoromethyl)benzyl bromide’s role as a synthetic intermediate contributes to the construction of complex structures for various applications, supporting scientific exploration and innovation.
CAS Number | 402-23-3 |
Synonyms | 1-(Bromomethyl)-3-(trifluoromethyl)benzene; α’-Bromo-α,α,α-trifluoro-m-xylene; 3-(Bromomethyl)-1-(trifluoromethyl)benzene; 3-(Bromomethyl)benzotrifluoride; 3-(Trifluoromethyl)benzyl Bromide; m-(Trifluoromethyl)benzyl Bromide; |
Molecular Formula | C8H6BrF3 |
Purity | ≥95% |
Storage | RT |
IUPAC Name | 1-(bromomethyl)-3-(trifluoromethyl)benzene |
InChI | InChI=1S/C8H6BrF3/c9-5-6-2-1-3-7(4-6)8(10,11)12/h1-4H,5H2 |
InChIKey | MYYYZNVAUZVXBO-UHFFFAOYSA-N |
SMILES | C1=CC(=CC(=C1)C(F)(F)F)CBr |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |