Home
>
Reference Standards> 3-(Trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine Hydrochloride
For research use only. Not for therapeutic Use.
3-(Trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine hydrochloride (Cat No.: R008916) is a heterocyclic compound featuring a fused triazolopyrazine core and a trifluoromethyl group at the 3-position. The tetrahydro modification enhances its solubility and metabolic properties, while the trifluoromethyl group contributes to increased lipophilicity and potential bioactivity. As a hydrochloride salt, it offers improved stability and handling. This compound is valuable in medicinal chemistry for designing CNS-active agents, enzyme inhibitors, or receptor modulators due to its favorable pharmacokinetic and structural characteristics.
CAS Number | 762240-92-6 |
Synonyms | 5,6,7,8-Tetrahydro-3-(trifluoromethyl)-1,2,4-triazolo[4,3-a]pyrazine Monohydrochloride |
Molecular Formula | C6H8ClF3N4 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-(trifluoromethyl)-5,6,7,8-tetrahydro-[1,2,4]triazolo[4,3-a]pyrazine;hydrochloride |
InChI | InChI=1S/C6H7F3N4.ClH/c7-6(8,9)5-12-11-4-3-10-1-2-13(4)5;/h10H,1-3H2;1H |
InChIKey | AQCSCRYRCRORET-UHFFFAOYSA-N |
SMILES | C1CN2C(=NN=C2C(F)(F)F)CN1.Cl |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |