For research use only. Not for therapeutic Use.
3-Tert-butylphenylboronic acid(Cat No.:L044055)is an organoboron compound featuring a phenyl group with a tert-butyl substituent at the 3-position and a boronic acid group (-B(OH)₂) at the 1-position. This compound is widely used in organic synthesis, particularly in Suzuki cross-coupling reactions to form carbon-carbon bonds. The bulky tert-butyl group provides steric hindrance, which can influence reaction selectivity and improve solubility in organic solvents. It is commonly employed in the synthesis of complex molecules, including pharmaceuticals and materials, and as a reagent in the development of functionalized organic compounds.
| CAS Number | 560132-24-3 |
| Molecular Formula | C10H15BO2 |
| Purity | ≥95% |
| IUPAC Name | (3-tert-butylphenyl)boronic acid |
| InChI | InChI=1S/C10H15BO2/c1-10(2,3)8-5-4-6-9(7-8)11(12)13/h4-7,12-13H,1-3H3 |
| InChIKey | OKBOGYOXEDEGOG-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)C(C)(C)C)(O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |