Home
>
Chemical Reagents>Organic Building Blocks> (3-((tert-Butyldimethylsilyl)oxy)phenyl)boronic acid
For research use only. Not for therapeutic Use.
(3-((tert-Butyldimethylsilyl)oxy)phenyl)boronic acid(Cat No.:L041706)is a protected boronic acid derivative featuring a tert-butyldimethylsilyl (TBDMS) ether group at the meta-position of the phenyl ring. The boronic acid functionality makes it a key reagent in Suzuki-Miyaura cross-coupling reactions, allowing the formation of C–C bonds in the synthesis of biaryl and heterocyclic compounds. The TBDMS group serves as a robust protecting group for phenols, offering stability under basic and mildly acidic conditions while being easily removable under fluoride-mediated conditions. This compound is widely used in medicinal and material chemistry for building complex molecular architectures.
| CAS Number | 261621-12-9 |
| Molecular Formula | C12H21BO3Si |
| Purity | ≥95% |
| IUPAC Name | [3-[tert-butyl(dimethyl)silyl]oxyphenyl]boronic acid |
| InChI | InChI=1S/C12H21BO3Si/c1-12(2,3)17(4,5)16-11-8-6-7-10(9-11)13(14)15/h6-9,14-15H,1-5H3 |
| InChIKey | RDQWADDNQONTLB-UHFFFAOYSA-N |
| SMILES | B(C1=CC(=CC=C1)O[Si](C)(C)C(C)(C)C)(O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |