For research use only. Not for therapeutic Use.
3-Pyridylboronic acid (Cat No.: M119407) is a heteroarylboronic acid featuring a boronic acid group attached to the 3-position of a pyridine ring. It is commonly used in Suzuki–Miyaura cross-coupling reactions to form carbon–carbon bonds between aryl or heteroaryl groups. This compound is valuable in the synthesis of pharmaceuticals, agrochemicals, and functional materials. Its nitrogen-containing aromatic ring offers additional coordination sites, enhancing reactivity and versatility in organic transformations. It is a key building block in heterocyclic and drug-like molecule design.
| CAS Number | 1692-25-7 |
| Molecular Formula | C5H6BNO2 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | pyridin-3-ylboronic acid |
| InChI | InChI=1S/C5H6BNO2/c8-6(9)5-2-1-3-7-4-5/h1-4,8-9H |
| InChIKey | ABMYEXAYWZJVOV-UHFFFAOYSA-N |
| SMILES | B(C1=CN=CC=C1)(O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
