For research use only. Not for therapeutic Use.
3-Oxopropyl acetate (CAT: M088290) is a chemical compound known for its utility in various applications. It serves as a versatile building block in organic synthesis, aiding in the creation of diverse molecules. This compound’s structure contains an acetate group and a ketone functional group, which contribute to its reactivity and potential for transformation into more complex compounds. The compound’s widespread use in synthesis underscores its significance in pharmaceutical research, materials science, and the chemical industry, where it plays a pivotal role in designing and developing novel molecules and materials for various applications.
| CAS Number | 18545-28-3 |
| Molecular Formula | C5H8O3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3-oxopropyl acetate |
| InChI | InChI=1S/C5H8O3/c1-5(7)8-4-2-3-6/h3H,2,4H2,1H3 |
| InChIKey | PRSPLAWXBFRHKV-UHFFFAOYSA-N |
| SMILES | CC(=O)OCCC=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |