For research use only. Not for therapeutic Use.
3-Oxetanecarboxylic Acid（Cat No.:M024727）is a valuable four-membered ring compound featuring an oxetane core substituted with a carboxylic acid functional group. As a strained heterocycle, it offers unique reactivity, making it a versatile building block in medicinal and synthetic chemistry. It serves as a bioisostere for carboxylic acids and esters, improving pharmacokinetic profiles in drug candidates. The oxetane ring enhances metabolic stability and modulates polarity, which is advantageous in designing orally bioavailable drugs. Its compact, electron-rich structure also finds applications in materials science and agrochemical research. Supplied in high purity, it is used primarily in research and development.
| CAS Number | 114012-41-8 |
| Synonyms | 3-OXETANECARBOXYLIC ACID |
| Molecular Formula | C4H6O3 |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | oxetane-3-carboxylic acid |
| InChI | InChI=1S/C4H6O3/c5-4(6)3-1-7-2-3/h3H,1-2H2,(H,5,6) |
| InChIKey | UWOTZNQZPLAURK-UHFFFAOYSA-N |
| SMILES | C1C(CO1)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
