For research use only. Not for therapeutic Use.
3-O-Methylquercetin（Cat No.:R054047）, also known as isorhamnetin, is a naturally occurring flavonol and methylated derivative of quercetin. The addition of a methyl group at the 3-position enhances its stability, lipophilicity, and bioavailability compared to quercetin. It exhibits a wide range of biological activities, including antioxidant, anti-inflammatory, anticancer, and cardioprotective effects. 3-O-Methylquercetin has been shown to modulate signaling pathways such as NF-κB and PI3K/Akt, regulate apoptosis, and protect against oxidative stress. As a bioactive flavonoid, it is studied for therapeutic potential in cancer, cardiovascular, and neurodegenerative diseases.
| CAS Number | 1486-70-0 |
| Synonyms | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-methoxychromen-4-one |
| Molecular Formula | C16H12O7 |
| Purity | ≥95% |
| IUPAC Name | 2-(3,4-dihydroxyphenyl)-5,7-dihydroxy-3-methoxychromen-4-one |
| InChI | InChI=1S/C16H12O7/c1-22-16-14(21)13-11(20)5-8(17)6-12(13)23-15(16)7-2-3-9(18)10(19)4-7/h2-6,17-20H,1H3 |
| InChIKey | WEPBGSIAWZTEJR-UHFFFAOYSA-N |
| SMILES | COC1=C(OC2=CC(=CC(=C2C1=O)O)O)C3=CC(=C(C=C3)O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
