3-O-α-D-Glucosyl Isomaltol (Cat No.:C000672) is a compound formed by the glycosylation of isomaltol with an α-D-glucose molecule. Isomaltol is a naturally occurring compound found in heat-treated foods. The addition of a glucose moiety creates a glycoside with potential applications in food science and flavor enhancement. Research on 3-O-α-D-Glucosyl Isomaltol may explore its taste-modifying properties, stability, and potential benefits in reducing off-flavors or enhancing sweetness in food products.
| Catalog Number | C000672 |
| CAS Number | 85559-61-1 |
| Synonyms | 1-[3-(α-D-Glucopyranosyloxy)-2-furanyl]ethanone; 2-Acetylfuran-3yl-α-D-glucopyranoside; |
| Molecular Formula | C₁₂H₁₆O₈ |
| Purity | ≥95% |
| Solubility | DMSO (Slightly), Methanol (Slightly, Heated) |
| Appearance | Off-White to Pale Beige Solid |
| Storage | -20°C, Hygroscopic |
| IUPAC Name | 1-[3-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxyfuran-2-yl]ethanone |
| InChI | InChI=1S/C12H16O8/c1-5(14)11-6(2-3-18-11)19-12-10(17)9(16)8(15)7(4-13)20-12/h2-3,7-10,12-13,15-17H,4H2,1H3/t7-,8-,9+,10-,12+/m1/s1 |
| InChIKey | RRYYNIJTMYUJDC-GPTQDWHKSA-N |
| SMILES | CC(=O)C1=C(C=CO1)OC2C(C(C(C(O2)CO)O)O)O |
| Reference | Guerra-Hernandez, E., et al.: J. Agric. Food Chem., 50, 7282 (2002); |
