For research use only. Not for therapeutic Use.
3-Nitrobenzanthrone(Cat No.:M082960) is a polycyclic aromatic compound known for its potent mutagenic and carcinogenic properties. It features a benzanthrone backbone substituted with a nitro group at the 3-position, which significantly enhances its reactivity and biological impact. This compound is primarily found in diesel exhaust and industrial emissions, contributing to environmental pollution. Its presence is of concern due to its potential health impacts, including DNA damage and cancer risk. Research into 3-nitrobenzanthrone focuses on understanding its mechanisms of action and developing methods to mitigate its presence and effects in the environment.
| CAS Number | 17117-34-9 |
| Molecular Formula | C17H9NO3 |
| Purity | ≥95% |
| Storage | Store at -20°C |
| IUPAC Name | 3-nitrobenzo[b]phenalen-7-one |
| InChI | InChI=1S/C17H9NO3/c19-17-12-5-2-1-4-10(12)11-8-9-15(18(20)21)13-6-3-7-14(17)16(11)13/h1-9H |
| InChIKey | QAJOWHGESRCVLY-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C3=C4C(=C(C=C3)[N+](=O)[O-])C=CC=C4C2=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |