For research use only. Not for therapeutic Use.
3-Nitro-L-tyrosine is a nitrated derivative of the amino acid L-tyrosine, featuring a nitro group (-NO2) attached to the benzene ring at the 3-position. This compound is of interest in biochemical research, as it is a marker of oxidative stress and nitrative damage, often associated with inflammation and neurodegenerative diseases. 3-Nitro-L-tyrosine is formed through the interaction of tyrosine with reactive nitrogen species, and its presence can indicate altered cellular processes, making it valuable in studying disease mechanisms and potential therapeutic interventions.
CAS Number | 621-44-3 |
Synonyms | L-3-Nitrotyrosine; NSC 37413; |
Molecular Formula | C9H10N2O5 |
Purity | ≥95% |
Target | Endogenous Metabolite |
Storage | Room temperature |
InChI | InChI=1S/C9H10N2O5/c10-6(9(13)14)3-5-1-2-8(12)7(4-5)11(15)16/h1-2,4,6,12H,3,10H2,(H,13,14)/t6-/m0/s1 |
InChIKey | FBTSQILOGYXGMD-LURJTMIESA-N |
SMILES | C1=CC(=C(C=C1CC(C(=O)O)N)[N+](=O)[O-])O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |