Home
>
Chemical Reagents>Heterocyclic Building Blocks> (3-Methylpyridin-2-yl)methanamine dihydrochloride
For research use only. Not for therapeutic Use.
(3-Methylpyridin-2-yl)methanamine dihydrochloride(Cat No.:L032820)is a chemical compound utilized as an intermediate in pharmaceutical synthesis and organic chemistry. Featuring a methylpyridine ring attached to a methanamine group, this compound is often used in the development of active pharmaceutical ingredients (APIs) and complex organic molecules. The dihydrochloride salt form enhances its solubility and stability, making it suitable for various reactions and formulations. Its role in medicinal chemistry includes the synthesis of potential therapeutic agents and the study of biological pathways, contributing to drug discovery and development.
| CAS Number | 357288-02-9 |
| Molecular Formula | C7H12Cl2N2 |
| Purity | ≥95% |
| IUPAC Name | (3-methylpyridin-2-yl)methanamine;dihydrochloride |
| InChI | InChI=1S/C7H10N2.2ClH/c1-6-3-2-4-9-7(6)5-8;;/h2-4H,5,8H2,1H3;2*1H |
| InChIKey | VSYUXSPAMHLAND-UHFFFAOYSA-N |
| SMILES | CC1=C(N=CC=C1)CN.Cl.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |