For research use only. Not for therapeutic Use.
3-Methylenecyanocyclobutane（Cat No.:R036981）is a strained, four-membered carbocyclic compound featuring a methylene group and a nitrile (cyano) substituent. This highly reactive molecule serves as a versatile intermediate in organic synthesis, particularly in the development of pharmaceuticals and advanced materials. The presence of both the methylene and cyano functional groups allows for a variety of chemical transformations, including cycloadditions, nucleophilic additions, and polymerizations. Its compact ring system imparts significant ring strain, making it useful for accessing complex molecular frameworks.
| CAS Number | 15760-35-7 |
| Synonyms | 3-Methylenecyclobutanecarbonitrile; 3-Methylene-1-cyanocyclobutane; 3-Methylenecyclobutane-1-carbonitrile; |
| Molecular Formula | C6H7N |
| Purity | ≥95% |
| Storage | Store at +4C |
| IUPAC Name | 3-methylidenecyclobutane-1-carbonitrile |
| InChI | InChI=1S/C6H7N/c1-5-2-6(3-5)4-7/h6H,1-3H2 |
| InChIKey | ZRWMAMOBIQQJSA-UHFFFAOYSA-N |
| SMILES | C=C1CC(C1)C#N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
