For research use only. Not for therapeutic Use.
3-Methylcyclopentanol(CAT: M075950) is a high-purity cyclic alcohol featuring a methyl group substituted at the 3-position of a cyclopentane ring. This versatile compound is commonly used as an intermediate in organic synthesis, particularly in the development of pharmaceuticals, fragrances, and specialty chemicals. Its well-defined structure and reactivity make it suitable for various chemical transformations, including oxidation, esterification, and coupling reactions. 3-Methylcyclopentanol is a reliable choice for research and industrial applications, supporting innovative approaches in medicinal chemistry, material science, and fine chemical production.
| CAS Number | 18729-48-1 |
| Molecular Formula | C6H12O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3-methylcyclopentan-1-ol |
| InChI | InChI=1S/C6H12O/c1-5-2-3-6(7)4-5/h5-7H,2-4H2,1H3 |
| InChIKey | VEALHWXMCIRWGC-UHFFFAOYSA-N |
| SMILES | CC1CCC(C1)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
