3-methyl-N,N-diphenylaniline - CAS 4316-54-5
3-methyl-N,N-diphenylaniline (Cat.No:L004825) is a significant organic compound with diverse applications. Its unique structure, featuring a methyl group and diphenylamine moiety, renders it valuable in the synthesis of dyes and pigments. This compound is utilized in the production of colorants for textiles and coatings. Its versatile reactivity and specific attributes make it an essential component in the development of various materials, emphasizing its importance in contemporary chemical research for applications in the dye and pigment industry.
Catalog Number: L004825
CAS Number: 4316-54-5
Molecular Formula: C19H17N
Molecular Weight:259.3
Purity: ≥95%
* For research use only. Not for human or veterinary use.
Property
| Molecular Formula: | C19H17N |
|---|---|
| Molecular Weight | 259.3 |
| Purity | ≥95% |
Computed Descriptor
| IUPAC Name | 3-methyl-N,N-diphenylaniline |
|---|---|
| InChI | InChI=1S/C19H17N/c1-16-9-8-14-19(15-16)20(17-10-4-2-5-11-17)18-12-6-3-7-13-18/h2-15H,1H3 |
| InChIKey | FHMZRXAOGIFMFL-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)N(C2=CC=CC=C2)C3=CC=CC=C3 |