For research use only. Not for therapeutic Use.
3-Methyl-diazirine-3-propanoic acid is a diazirine-containing compound used in photochemical and biochemical research, particularly in photo-crosslinking studies. The diazirine group forms reactive carbene intermediates when exposed to UV light, allowing it to covalently bind to nearby biomolecules. This property makes it a powerful tool for mapping protein-ligand interactions and studying biological pathways. Additionally, the carboxylic acid group enables conjugation to other molecules, enhancing its utility in creating probes for advanced biochemical applications and molecular research.
CAS Number | 25055-86-1 |
Synonyms | 3-(3-Methyldiazirin-3-yl)propanoic Acid; 3-(3-Methyl-3-diazirinyl)propanoic Acid; 4,4-Azopentanoic Acid; 3-(3-methyl-3H-diazirin-3-yl)-propionic Acid; 3-(3-Methyl-diazirin-3-yl)-propanoic Acid; |
Molecular Formula | C5H8N2O2 |
Purity | ≥95% |
Storage | -20°C |
IUPAC Name | 3-(3-methyldiazirin-3-yl)propanoic acid |
InChI | InChI=1S/C5H8N2O2/c1-5(6-7-5)3-2-4(8)9/h2-3H2,1H3,(H,8,9) |
InChIKey | DSOGRJSLWCABBW-UHFFFAOYSA-N |
SMILES | CC1(N=N1)CCC(=O)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |