For research use only. Not for therapeutic Use.
3-Methyl-5-isopropyl-4-carbethoxy-2-cyclohexene-1-one (Cat.No:L004121) is a significant compound in organic synthesis. Its unique cyclohexenone structure, featuring methyl, isopropyl, and carbethoxy substituents, imparts distinctive reactivity. This compound is employed as a valuable intermediate in the preparation of specialized organic molecules with various applications in pharmaceutical and chemical research.
CAS Number | 24079-95-6 |
Molecular Formula | C13H20O3 |
Purity | ≥95% |
IUPAC Name | ethyl 2-methyl-4-oxo-6-propan-2-ylcyclohex-2-ene-1-carboxylate |
InChI | InChI=1S/C13H20O3/c1-5-16-13(15)12-9(4)6-10(14)7-11(12)8(2)3/h6,8,11-12H,5,7H2,1-4H3 |
InChIKey | QBMOPULUXAKJTR-UHFFFAOYSA-N |
SMILES | CCOC(=O)C1C(CC(=O)C=C1C)C(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |