For research use only. Not for therapeutic Use.
3-Methyl-3H-diazirine-3-propanol(Cat No.:M131573) is a chemical compound with the molecular formula C5H10N2O. It is a diazirine derivative, containing a diazirine ring (a three-membered ring with two nitrogen atoms and one carbon atom) attached to a propane chain with a hydroxyl group. This compound is widely used in photoaffinity labeling studies in biochemistry and molecular biology. Upon exposure to ultraviolet (UV) light, the diazirine ring undergoes a photochemical reaction, forming a highly reactive carbene intermediate that can covalently cross-link with nearby biomolecules.
| CAS Number | 16297-94-2 |
| Molecular Formula | C5H10N2O |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 3-(3-methyldiazirin-3-yl)propan-1-ol |
| InChI | InChI=1S/C5H10N2O/c1-5(6-7-5)3-2-4-8/h8H,2-4H2,1H3 |
| InChIKey | DJJQQKQBBXUDCM-UHFFFAOYSA-N |
| SMILES | CC1(N=N1)CCCO |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |