For research use only. Not for therapeutic Use.
3-Methyl-2H-1,3-benzoxazine-2,4(3H)-dione(Cat No.:M119525), also known as 3-methylisatoic anhydride, is a chemical compound with the molecular formula C9H7NO3. It is a derivative of isotonic anhydride, featuring a methyl group at the 3-position of the benzene ring. This compound is primarily used in organic synthesis as a building block to create various complex molecules. It is known for its ability to participate in various reactions, such as amidation and cyclization reactions, to form diverse heterocyclic compounds. Its structural motif is found in pharmaceuticals and materials chemistry, making it a valuable intermediate in chemical research and industry.
| CAS Number | 1672-01-1 |
| Synonyms | 3-Methyl-2H-1,3-benzoxazine-2,4(3H)-dione |
| Molecular Formula | C9H7NO3 |
| Purity | ≥95% |
| Storage | Store at RT |
| IUPAC Name | 3-methyl-1,3-benzoxazine-2,4-dione |
| InChI | InChI=1S/C9H7NO3/c1-10-8(11)6-4-2-3-5-7(6)13-9(10)12/h2-5H,1H3 |
| InChIKey | FBZWKVSQOBDAQR-UHFFFAOYSA-N |
| SMILES | CN1C(=O)C2=CC=CC=C2OC1=O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |