For research use only. Not for therapeutic Use.
3-Methoxybenzene-1,2-diamine(Cat No.:L012442), also known as 3-methoxy-o-phenylenediamine, is an aromatic diamine featuring two adjacent amino groups at the 1 and 2 positions and a methoxy group at the 3 position on a benzene ring. This compound serves as a key intermediate in the synthesis of heterocyclic compounds, particularly benzimidazoles and quinoxalines, through cyclization reactions. The methoxy group influences electronic properties, enhancing nucleophilicity and reactivity of the adjacent amino groups. It is used in pharmaceutical research, dye chemistry, and material science, where functionalized aromatic diamines are needed for complex molecule development.
| CAS Number | 37466-89-0 |
| Molecular Formula | C7H10N2O |
| Purity | ≥95% |
| IUPAC Name | 3-methoxybenzene-1,2-diamine |
| InChI | InChI=1S/C7H10N2O/c1-10-6-4-2-3-5(8)7(6)9/h2-4H,8-9H2,1H3 |
| InChIKey | BFLWXPJTAKXXKT-UHFFFAOYSA-N |
| SMILES | COC1=CC=CC(=C1N)N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |