For research use only. Not for therapeutic Use.
3-Methoxy-4-methylbenzaldehyde(Cat No.:L015314)is an aromatic aldehyde featuring a methoxy group at the 3-position and a methyl group at the 4-position relative to the formyl group on a benzene ring. This substitution pattern imparts both electron-donating and steric effects, influencing the compound’s reactivity in electrophilic aromatic substitution and condensation reactions. It is commonly used as an intermediate in the synthesis of fragrances, pharmaceuticals, and fine chemicals. The methoxy group enhances aromatic stability, while the aldehyde function allows for modifications such as Schiff base formation, making it versatile in organic synthesis and material design.
| CAS Number | 24973-22-6 |
| Molecular Formula | C9H10O2 |
| Purity | ≥95% |
| IUPAC Name | 3-methoxy-4-methylbenzaldehyde |
| InChI | InChI=1S/C9H10O2/c1-7-3-4-8(6-10)5-9(7)11-2/h3-6H,1-2H3 |
| InChIKey | TVDHPUFLDYYBPO-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)C=O)OC |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |