For research use only. Not for therapeutic Use.
3-Maleimidopropionic acid (Cat No.: R000680) is a bifunctional compound featuring a maleimide group and a carboxylic acid group on a three-carbon backbone. The maleimide moiety is highly reactive toward thiol groups, making it ideal for site-specific conjugation of proteins, peptides, or other thiol-containing molecules. The carboxylic acid group allows for further derivatization or coupling to other functional groups. It is widely used in bioconjugation, drug delivery systems, and antibody–drug conjugates (ADCs), offering high selectivity and efficiency in biochemical and biomedical applications.
| CAS Number | 7423-55-4 |
| Synonyms | 2,5-Dihydro-2,5-dioxo-1H-pyrrole-1-propanoic Acid; 3-(2,5-Dioxo-2,5-dihydro-pyrrol-1-yl)-propionic Acid; N-(2-Carboxyethyl)maleimide; N-Maleoyl-β-alanine; |
| Molecular Formula | C7H7NO4 |
| Purity | ≥95% |
| Target | PROTAC Linkers |
| Storage | Store at RT |
| IUPAC Name | 3-(2,5-dioxopyrrol-1-yl)propanoic acid |
| InChI | InChI=1S/C7H7NO4/c9-5-1-2-6(10)8(5)4-3-7(11)12/h1-2H,3-4H2,(H,11,12) |
| InChIKey | IUTPJBLLJJNPAJ-UHFFFAOYSA-N |
| SMILES | C1=CC(=O)N(C1=O)CCC(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |