For research use only. Not for therapeutic Use.
3-Isopropoxy-4-(tributylstannyl)-1,2-cyclobutenedione, also known as a Liebeskind reagent, is a specialized organostannane compound used in organic synthesis, particularly in cross-coupling reactions. This reagent plays a key role in the Liebeskind-Srogl reaction, facilitating the formation of carbon-carbon bonds without requiring traditional transition-metal catalysts like palladium. Its structure, featuring a cyclobutenedione core with isopropoxy and tributylstannyl groups, allows for highly selective reactions, making it valuable in complex molecule synthesis, medicinal chemistry, and the development of bioactive compounds.
CAS Number | 129034-70-4 |
Molecular Formula | C19H34O3Sn |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 3-propan-2-yloxy-4-tributylstannylcyclobut-3-ene-1,2-dione |
InChI | InChI=1S/C7H7O3.3C4H9.Sn/c1-4(2)10-6-3-5(8)7(6)9;3*1-3-4-2;/h4H,1-2H3;3*1,3-4H2,2H3; |
InChIKey | AMVLEBHYELFWJT-UHFFFAOYSA-N |
SMILES | CCCC[Sn](CCCC)(CCCC)C1=C(C(=O)C1=O)OC(C)C |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |