Home
>
Chemical Reagents>Heterocyclic Building Blocks> 3-iodo-7-methoxy-1-methyl-1H-pyrrolo[2,3-c]pyridine
For research use only. Not for therapeutic Use.
3-Iodo-7-methoxy-1-methyl-1H-pyrrolo[2,3-c]pyridine is a nitrogen-containing heterocyclic compound characterized by a pyrrolopyridine framework. It features an iodine atom at the 3-position and a methoxy group at the 7-position, alongside a methyl group. This structure provides unique electronic and steric properties, making it a candidate for various biological studies. The compound may exhibit potential pharmacological activities, and its distinct reactivity allows for further functionalization in synthetic organic chemistry, contributing to the development of new therapeutic agents.
CAS Number | 1627713-57-8 |
Molecular Formula | C9H9IN2O |
Purity | ≥95% |
IUPAC Name | 3-iodo-7-methoxy-1-methylpyrrolo[2,3-c]pyridine |
InChI | InChI=1S/C9H9IN2O/c1-12-5-7(10)6-3-4-11-9(13-2)8(6)12/h3-5H,1-2H3 |
InChIKey | KQEIELIOQYUIPK-UHFFFAOYSA-N |
SMILES | CN1C=C(C2=C1C(=NC=C2)OC)I |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |