For research use only. Not for therapeutic Use.
3-Iodo-5-methylbenzoic acid(Cat No.:L010709)is a valuable compound used in pharmaceutical and chemical research. With an iodine atom at the 3-position and a methyl group at the 5-position on the benzoic acid ring, this compound serves as an important intermediate in the synthesis of various bioactive molecules. Its unique structure allows for diverse chemical modifications, making it essential in the development of new therapeutic agents and in the exploration of novel chemical pathways. It is particularly useful in medicinal chemistry, supporting innovative research and drug discovery efforts.
| CAS Number | 52107-90-1 |
| Molecular Formula | C8H7IO2 |
| Purity | ≥95% |
| IUPAC Name | 3-iodo-5-methylbenzoic acid |
| InChI | InChI=1S/C8H7IO2/c1-5-2-6(8(10)11)4-7(9)3-5/h2-4H,1H3,(H,10,11) |
| InChIKey | FDSUTRCVLDJUCI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1)I)C(=O)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |