For research use only. Not for therapeutic Use.
3-Iodo-5-methyl-1H-pyrrolo[3,2-b]pyridine(Cat No.:L032578)is a halogenated heteroaromatic compound consisting of a fused pyrrole and pyridine ring system, with an iodine atom at the 3-position and a methyl group at the 5-position. This compound is commonly used as an intermediate in the synthesis of pharmaceuticals and bioactive molecules. The iodine substituent serves as a reactive handle for cross-coupling reactions like Suzuki or Sonogashira, allowing the introduction of various functional groups. Its rigid, electron-rich structure supports strong target binding, making it a valuable scaffold in drug discovery and heterocyclic chemistry.
CAS Number | 1000343-70-3 |
Molecular Formula | C8H7IN2 |
Purity | ≥95% |
IUPAC Name | 3-iodo-5-methyl-1H-pyrrolo[3,2-b]pyridine |
InChI | InChI=1S/C8H7IN2/c1-5-2-3-7-8(11-5)6(9)4-10-7/h2-4,10H,1H3 |
InChIKey | GDIZDNULTIJUGM-UHFFFAOYSA-N |
SMILES | CC1=NC2=C(C=C1)NC=C2I |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |