3-(Imidazole-1-sulfonyl)-1-methyl-3H-imidazol-1-ium triflate（Cat No.:L029678）is an imidazolium-based ionic liquid featuring an imidazole sulfonyl group and a triflate counterion. This compound is commonly used in organic synthesis and catalysis due to its stability and ionic nature, which can enhance reaction efficiency. The sulfonyl group provides unique reactivity, making it useful in the development of novel catalytic processes and as a reagent in various chemical transformations. Its ionic character also makes it valuable in electrochemistry and materials science. High purity ensures consistent performance in advanced research and industrial applications.
| Catalog Number | L029678 |
| CAS Number | 489471-57-0 |
| Molecular Formula | C8H9F3N4O5S2 |
| Purity | ≥95% |
| IUPAC Name | 1-imidazol-1-ylsulfonyl-3-methylimidazol-3-ium;trifluoromethanesulfonate |
| InChI | InChI=1S/C7H9N4O2S.CHF3O3S/c1-9-4-5-11(7-9)14(12,13)10-3-2-8-6-10;2-1(3,4)8(5,6)7/h2-7H,1H3;(H,5,6,7)/q+1;/p-1 |
| InChIKey | WNPFDMGMNSMOMD-UHFFFAOYSA-M |
| SMILES | C[N+]1=CN(C=C1)S(=O)(=O)N2C=CN=C2.C(F)(F)(F)S(=O)(=O)[O-] |
