For research use only. Not for therapeutic Use.
3-Hydroxyadamantan-1-yl Acrylate(Cat No.:L036523)is a versatile chemical compound utilized primarily in polymer chemistry due to its unique adamantane structure, which imparts high thermal stability and resistance to oxidative degradation. The hydroxy group at the 3-position allows for further functionalization and increases the compound’s solubility in various solvents. The acrylate functionality enables it to undergo free radical polymerization, creating polymers with exceptional durability and mechanical strength. This compound is essential in the development of advanced materials, including coatings and adhesives, where performance under extreme conditions is critical.
CAS Number | 216581-76-9 |
Molecular Formula | C13H18O3 |
Purity | ≥95% |
IUPAC Name | (3-hydroxy-1-adamantyl) prop-2-enoate |
InChI | InChI=1S/C13H18O3/c1-2-11(14)16-13-6-9-3-10(7-13)5-12(15,4-9)8-13/h2,9-10,15H,1,3-8H2 |
InChIKey | DKDKCSYKDZNMMA-UHFFFAOYSA-N |
SMILES | C=CC(=O)OC12CC3CC(C1)CC(C3)(C2)O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |