Home
>
Chemical Reagents>Organic Building Blocks>Buliding Block Chemicals> 3-Hydroxy-4-methoxybenzonitrile
For research use only. Not for therapeutic Use.
3-Hydroxy-4-methoxybenzonitrile(CAT: L040454) is a functionalized aromatic compound featuring a hydroxyl group at the meta position, a methoxy group at the para position, and a nitrile group on the benzene ring. This molecule serves as a valuable intermediate in pharmaceutical, agrochemical, and fine chemical synthesis. The hydroxyl and methoxy groups provide electron-donating properties and enhance reactivity in electrophilic aromatic substitution, while the nitrile group allows for further transformations into amides, carboxylic acids, or heterocycles.
| CAS Number | 52805-46-6 |
| Molecular Formula | C8H7NO2 |
| Purity | ≥95% |
| IUPAC Name | 3-hydroxy-4-methoxybenzonitrile |
| InChI | InChI=1S/C8H7NO2/c1-11-8-3-2-6(5-9)4-7(8)10/h2-4,10H,1H3 |
| InChIKey | ASQHIJLQYYFUDN-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)C#N)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |