For research use only. Not for therapeutic Use.
3-Fluoroquinolin-5-ol(Cat No.:L028955)is a high-purity fluorinated quinoline derivative commonly used in pharmaceutical research and organic synthesis. Featuring a fluorine atom at the 3-position and a hydroxyl group at the 5-position, this compound is vital for the development of bioactive molecules, particularly in the design of antimicrobial and anticancer agents. Its unique structure allows for targeted modifications, making it a valuable intermediate in medicinal chemistry. 3-Fluoroquinolin-5-ol offers consistent performance and reliability, supporting complex synthetic pathways in advanced chemical research.
| CAS Number | 1261729-67-2 |
| Molecular Formula | C9H6FNO |
| Purity | ≥95% |
| IUPAC Name | 3-fluoroquinolin-5-ol |
| InChI | InChI=1S/C9H6FNO/c10-6-4-7-8(11-5-6)2-1-3-9(7)12/h1-5,12H |
| InChIKey | LYPUHYGYYPHSOX-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C(C=N2)F)C(=C1)O |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |