For research use only. Not for therapeutic Use.
3-Fluoromethamphetamine (3-FMA, hydrochloride)（Cat No.:R067530）is a synthetic stimulant belonging to the substituted amphetamine class. Characterized by a fluorine atom at the meta (3-) position of the phenyl ring, it is structurally similar to methamphetamine but exhibits distinct pharmacological properties. 3-FMA acts as a monoamine releaser, primarily affecting dopamine and norepinephrine systems, producing stimulant and euphoriant effects. The hydrochloride salt form enhances its water solubility and stability, making it suitable for laboratory research. It is commonly studied in the context of designer drug analysis, neurochemical profiling, and forensic toxicology.
| CAS Number | 1324717-74-9 |
| Synonyms | 3-FMA |
| Molecular Formula | C10H15ClFN |
| Purity | ≥95% |
| Storage | -20°C |
| IUPAC Name | 1-(3-fluorophenyl)-N-methylpropan-2-amine;hydrochloride |
| InChI | InChI=1S/C10H14FN.ClH/c1-8(12-2)6-9-4-3-5-10(11)7-9;/h3-5,7-8,12H,6H2,1-2H3;1H |
| InChIKey | YMSKCWWRRHZMMD-UHFFFAOYSA-N |
| SMILES | CC(CC1=CC(=CC=C1)F)NC.Cl |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |
