For research use only. Not for therapeutic Use.
(3-Fluoro-5-iodophenyl)methanol(CAT: L011458) is a halogen-substituted aromatic alcohol valuable in pharmaceutical and chemical research for the synthesis of complex organic molecules. This compound, featuring both fluoro and iodo substituents on a benzene ring with a methanol group, is often utilized in the design of intermediates for biologically active compounds. The unique halogenation pattern contributes to the compound’s reactivity, allowing for further functionalization in synthetic pathways. Its structure makes it particularly useful in medicinal chemistry for creating molecular scaffolds that are investigated for various pharmacological applications, including as potential ligands or as components in the study of enzyme interactions.
CAS Number | 1261837-87-9 |
Molecular Formula | C7H6FIO |
Purity | ≥95% |
IUPAC Name | (3-fluoro-5-iodophenyl)methanol |
InChI | InChI=1S/C7H6FIO/c8-6-1-5(4-10)2-7(9)3-6/h1-3,10H,4H2 |
InChIKey | FVPNYCKCRUTKOB-UHFFFAOYSA-N |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |