For research use only. Not for therapeutic Use.
3-Fluoro-4-nitrotoluene(Cat No.:L048063)is an aromatic compound featuring a toluene core substituted with a fluorine atom at the 3-position and a nitro group at the 4-position. This dual substitution imparts both electron-withdrawing and halogen properties, making the molecule highly reactive in electrophilic aromatic substitution and nucleophilic aromatic substitution reactions. It serves as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and dyes. The presence of the nitro and fluoro groups allows for further functionalization, while the methyl group contributes to moderate hydrophobicity. Its structure supports applications in fine chemical and heterocycle development.
CAS Number | 446-34-4 |
Molecular Formula | C7H6FNO2 |
Purity | ≥95% |
IUPAC Name | 2-fluoro-4-methyl-1-nitrobenzene |
InChI | InChI=1S/C7H6FNO2/c1-5-2-3-7(9(10)11)6(8)4-5/h2-4H,1H3 |
InChIKey | WZMOWQCNPFDWPA-UHFFFAOYSA-N |
SMILES | CC1=CC(=C(C=C1)[N+](=O)[O-])F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |