For research use only. Not for therapeutic Use.
3-Fluoro-4-methoxy-5-nitrobenzoic acid(CAT: L024721) is a fluorinated aromatic carboxylic acid featuring a methoxy group at the 4-position and a nitro group at the 5-position. This compound is a versatile intermediate in pharmaceutical and chemical research, often used in the synthesis of bioactive molecules and complex organic compounds. Its unique combination of functional groups provides opportunities for diverse chemical modifications, making it valuable in medicinal chemistry and material science applications. With high purity and excellent stability, 3-Fluoro-4-methoxy-5-nitrobenzoic acid is an essential building block for innovative drug discovery and synthetic chemistry projects.
CAS Number | 577-39-9 |
Molecular Formula | C8H6FNO5 |
Purity | ≥95% |
IUPAC Name | 3-fluoro-4-methoxy-5-nitrobenzoic acid |
InChI | InChI=1S/C8H6FNO5/c1-15-7-5(9)2-4(8(11)12)3-6(7)10(13)14/h2-3H,1H3,(H,11,12) |
InChIKey | FZVATVOZGBMDRQ-UHFFFAOYSA-N |
SMILES | COC1=C(C=C(C=C1F)C(=O)O)[N+](=O)[O-] |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |