For research use only. Not for therapeutic Use.
3-Fluoro-4-(4-fluorophenoxy)aniline(Cat No.:L041989)is an aromatic amine used in pharmaceutical research and organic synthesis. The compound features a fluorinated aniline core with an additional fluorophenoxy group, providing unique electronic properties and reactivity. It is particularly valuable in the development of biologically active molecules, where the presence of fluorine atoms can enhance metabolic stability, binding affinity, and overall bioavailability. This compound is often employed as an intermediate in the synthesis of complex drugs and fine chemicals, making it essential for researchers focused on drug discovery and medicinal chemistry.
CAS Number | 937597-91-6 |
Molecular Formula | C12H9F2NO |
Purity | ≥95% |
IUPAC Name | 3-fluoro-4-(4-fluorophenoxy)aniline |
InChI | InChI=1S/C12H9F2NO/c13-8-1-4-10(5-2-8)16-12-6-3-9(15)7-11(12)14/h1-7H,15H2 |
InChIKey | QYWIZFMOOPOWGU-UHFFFAOYSA-N |
SMILES | C1=CC(=CC=C1OC2=C(C=C(C=C2)N)F)F |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |