For research use only. Not for therapeutic Use.
3-Fluoro-2-nitrobenzaldehyde(Cat No.:L030153)is an aromatic compound featuring a fluorine atom at the 3-position, a nitro group at the 2-position, and an aldehyde group at the 1-position of the benzene ring. This electron-deficient molecule is valuable in organic synthesis, particularly in the preparation of heterocycles, pharmaceuticals, and agrochemicals. The nitro and fluoro substituents influence the compound’s reactivity, enabling selective transformations such as nucleophilic aromatic substitution or condensation reactions. Its structural motif is often used in medicinal chemistry for developing bioactive molecules with antimicrobial, anti-inflammatory, or anticancer potential through further functionalization.
CAS Number | 872366-63-7 |
Molecular Formula | C7H4FNO3 |
Purity | ≥95% |
IUPAC Name | 3-fluoro-2-nitrobenzaldehyde |
InChI | InChI=1S/C7H4FNO3/c8-6-3-1-2-5(4-10)7(6)9(11)12/h1-4H |
InChIKey | RJXDOIOYJGQGQH-UHFFFAOYSA-N |
SMILES | C1=CC(=C(C(=C1)F)[N+](=O)[O-])C=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |