For research use only. Not for therapeutic Use.
3-Ethylcyclopentane-1,2-dione(Cat No.:M051846) is an organic compound characterized by a cyclopentane ring substituted with ethyl groups and containing a 1,2-dione configuration. This structure places two carbonyl groups (C=O) adjacent to each other on the ring, significantly impacting the chemical reactivity and properties of the molecule. It appears as a colorless to pale yellow liquid, used primarily in organic synthesis as an intermediate for the production of more complex chemical entities. Its unique structure makes it valuable for research in developing pharmaceuticals and agrochemicals, where specific ring structures are often crucial for biological activity.
CAS Number | 13494-08-1 |
Synonyms | 3-ethylcyclopentane-1,2-dione |
Molecular Formula | C7H10O2 |
Purity | ≥95% |
Storage | Store at -20°C |
IUPAC Name | 3-ethylcyclopentane-1,2-dione |
InChI | InChI=1S/C7H10O2/c1-2-5-3-4-6(8)7(5)9/h5H,2-4H2,1H3 |
InChIKey | RRVYBPVLSILURP-UHFFFAOYSA-N |
SMILES | CCC1CCC(=O)C1=O |
Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |