For research use only. Not for therapeutic Use.
3-(Ethylamino)benzonitrile(Cat No.:L007457), is a chemical compound with the molecular formula C9H10N2. This compound consists of a benzene ring attached to a nitrile group (benzonitrile) with an ethylamino (-C2H5NH2) substituent. The presence of both an amino group and a nitrile group in its structure gives this compound versatile reactivity and functionality in organic synthesis. Researchers use 3-(methylamino)benzonitrile as a building block in the preparation of various chemical compounds, including pharmaceuticals and agrochemicals.
| CAS Number | 883742-00-5 |
| Molecular Formula | C9H10N2 |
| Purity | ≥95% |
| IUPAC Name | 3-(ethylamino)benzonitrile |
| InChI | InChI=1S/C9H10N2/c1-2-11-9-5-3-4-8(6-9)7-10/h3-6,11H,2H2,1H3 |
| InChIKey | HWXWPZQREZOXJJ-UHFFFAOYSA-N |
| SMILES | CCNC1=CC=CC(=C1)C#N |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |