For research use only. Not for therapeutic Use.
3-Ethyl-2,4-dimethyl-1H-pyrrole (Cat.No:R015382) is a chemical compound with a pyrrole ring structure. It is utilized in organic synthesis for its diverse reactivity and as a building block for pharmaceuticals, agrochemicals, and functional materials. Its unique structure makes it valuable in the development of various molecular architectures.
| CAS Number | 517-22-6 |
| Synonyms | 3-Ethyl-2,4-dimethylpyrrole; Cryptopyrrole; Kryptopyrrol; Kryptopyrrole; NSC 62025; 2,4-Dimethyl-3-ethyl-1H-pyrrole; 2,4-Dimethyl-3-ethylpyrrole |
| Molecular Formula | C8H13N |
| Purity | ≥95% |
| Storage | Desiccate at RT |
| IUPAC Name | 3-ethyl-2,4-dimethyl-1H-pyrrole |
| InChI | InChI=1S/C8H13N/c1-4-8-6(2)5-9-7(8)3/h5,9H,4H2,1-3H3 |
| InChIKey | ZEBBLOXDLGIMEG-UHFFFAOYSA-N |
| SMILES | CCC1=C(NC=C1C)C |
| Reference | <p> |
| Chemistry Calculators | Dilution Calculator In vivo Formulation Calculator Molarity Calculator Molecular Weight Calculator Reconstitution Calculator |